CAS 7500-78-9

2-benzoylbenzamide

Description:

2-Benzoylbenzamide, with the CAS number 7500-78-9, is an organic compound characterized by its structural features, which include a benzamide moiety substituted with a benzoyl group at the ortho position. This compound typically appears as a white to off-white crystalline solid and is known for its relatively low solubility in water, while being more soluble in organic solvents such as ethanol and acetone. It exhibits a melting point that is characteristic of similar aromatic compounds. 2-Benzoylbenzamide is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its chemical properties include the ability to undergo typical reactions of amides and ketones, such as hydrolysis and acylation. Additionally, it may exhibit biological activity, making it of interest in medicinal chemistry. As with many organic compounds, proper handling and safety precautions are essential due to potential toxicity and reactivity.

Formula: C₁₄H₁₁NO₂

InChI: InChI=1/C14H11NO2/c15-14(17)12-9-5-4-8-11(12)13(16)10-6-2-1-3-7-10/h1-9H,(H2,15,17)

SMILES: c1ccc(cc1)C(=O)c1ccccc1C(=N)O

Synonyms:

• 2-Benzoylphenylformamide

2-Benzoylbenzamide

Controlled Product

CAS: 7500-78-9

Formula: C₁₄H₁₁NO₂

Color and Shape: Neat

Molecular weight: 225.243

Ref: TR-B207830