CAS 75006-53-0
:13-Hexyl-1,4,7,10-tetraoxa-13-azacyclopentadecane
Description:
13-Hexyl-1,4,7,10-tetraoxa-13-azacyclopentadecane, with the CAS number 75006-53-0, is a synthetic compound characterized by its unique structure, which includes a cyclic framework containing both nitrogen and oxygen atoms. This compound features a 15-membered ring that incorporates four ether (–O–) linkages and one nitrogen atom, contributing to its potential as a ligand in coordination chemistry. The presence of the hexyl group enhances its hydrophobic characteristics, which may influence its solubility and interaction with biological membranes. The tetraoxa and azacyclo components suggest that it may exhibit interesting properties in terms of complexation with metal ions, making it potentially useful in applications such as catalysis or drug delivery. Additionally, the structural features may impart specific conformational flexibility, which can affect its reactivity and binding properties. Overall, this compound's unique combination of elements and structure positions it as a subject of interest in both synthetic and applied chemistry fields.
Formula:C16H33NO4
InChI:InChI=1S/C16H33NO4/c1-2-3-4-5-6-17-7-9-18-11-13-20-15-16-21-14-12-19-10-8-17/h2-16H2,1H3
InChI key:InChIKey=UNDPIHWFQWDTGX-UHFFFAOYSA-N
SMILES:C(CCCCC)N1CCOCCOCCOCCOCC1
Synonyms:- 1,4,7,10-Tetraoxa-13-azacyclopentadecane, 13-hexyl-
- 13-Hexyl-1,4,7,10-tetraoxa-13-azacyclopentadecane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
