CAS 75006-54-1
:13-Octyl-1,4,7,10-tetraoxa-13-azacyclopentadecane
Description:
13-Octyl-1,4,7,10-tetraoxa-13-azacyclopentadecane, with CAS number 75006-54-1, is a synthetic compound characterized by its unique structure that includes a cyclic framework containing both oxygen and nitrogen atoms. This compound features a 15-membered ring, which incorporates four ether (–O–) linkages and one nitrogen atom, contributing to its potential as a ligand in coordination chemistry. The presence of the octyl group enhances its hydrophobic characteristics, making it soluble in organic solvents while potentially limiting its solubility in water. The tetraoxa and azacyclo structure suggests that it may exhibit interesting properties such as chelation with metal ions, which can be useful in various applications, including catalysis and materials science. Additionally, the compound's structural features may impart specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and potential uses. Overall, this compound represents a fascinating area of study within the field of organic and coordination chemistry.
Formula:C18H37NO4
InChI:InChI=1S/C18H37NO4/c1-2-3-4-5-6-7-8-19-9-11-20-13-15-22-17-18-23-16-14-21-12-10-19/h2-18H2,1H3
InChI key:InChIKey=KMPVQUCVSURRIT-UHFFFAOYSA-N
SMILES:C(CCCCCCC)N1CCOCCOCCOCCOCC1
Synonyms:- 13-Octyl-1,4,7,10-tetraoxa-13-azacyclopentadecane
- 1,4,7,10-Tetraoxa-13-azacyclopentadecane, 13-octyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
