
CAS 75006-55-2
:13-Decyl-1,4,7,10-tetraoxa-13-azacyclopentadecane
Description:
13-Decyl-1,4,7,10-tetraoxa-13-azacyclopentadecane, with CAS number 75006-55-2, is a synthetic compound characterized by its unique structure that includes a cyclic framework containing both nitrogen and oxygen atoms. This compound features a 15-membered ring, incorporating four ether (–O–) linkages and one nitrogen atom, which contributes to its potential as a ligand in coordination chemistry. The presence of a decyl group enhances its hydrophobic properties, making it soluble in organic solvents while potentially limiting its solubility in water. The tetraoxa and azacyclo structure suggests that it may exhibit interesting chelating properties, allowing it to form stable complexes with various metal ions. Such characteristics make it of interest in fields such as materials science, catalysis, and possibly in biological applications. Its stability, reactivity, and interaction with other chemical species would depend on the specific conditions and environments in which it is used. Further studies would be necessary to fully explore its potential applications and behavior in different chemical contexts.
Formula:C20H41NO4
InChI:InChI=1S/C20H41NO4/c1-2-3-4-5-6-7-8-9-10-21-11-13-22-15-17-24-19-20-25-18-16-23-14-12-21/h2-20H2,1H3
InChI key:InChIKey=OQYMCCVEJUOMCX-UHFFFAOYSA-N
SMILES:C(CCCCCCCCC)N1CCOCCOCCOCCOCC1
Synonyms:- 1,4,7,10-Tetraoxa-13-azacyclopentadecane, 13-decyl-
- 13-Decyl-1,4,7,10-tetraoxa-13-azacyclopentadecane
- N-decylmonoaza-15-crown-5
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
