CAS 75007-86-2

2-(4-bromophenyl)-1H-imidazo[4,5-b]pyridine

Description:

2-(4-Bromophenyl)-1H-imidazo[4,5-b]pyridine, with the CAS number 75007-86-2, is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings. This compound features a bromophenyl substituent, which enhances its chemical reactivity and potential biological activity. It typically appears as a solid at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The presence of the bromine atom introduces significant electronegativity, influencing the compound's electronic properties and reactivity. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in targeting specific biological pathways. Its structural features may contribute to interactions with various biological targets, making it a candidate for further research in pharmacology. Additionally, the compound's stability and reactivity can be influenced by the presence of the bromine atom, which can participate in electrophilic substitution reactions. Overall, 2-(4-bromophenyl)-1H-imidazo[4,5-b]pyridine is a compound of significant interest in both synthetic and medicinal chemistry.

Formula: C₁₂H₈BrN₃

InChI: InChI=1/C12H8BrN3/c13-9-5-3-8(4-6-9)11-15-10-2-1-7-14-12(10)16-11/h1-7H,(H,14,15,16)

SMILES: c1cc2c(nc1)nc(c1ccc(cc1)Br)[nH]2

2-(4-Bromophenyl)-3h-imidazo[4,5-b]pyridine

CAS: 75007-86-2

2-(4-Bromophenyl)-3h-imidazo[4,5-b]pyridine

Purity: 97%

Ref: 54-OR1041806