CAS 75007-92-0
:2-phenyl-3H-imidazo[4,5-c]pyridine
Description:
2-Phenyl-3H-imidazo[4,5-c]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a planar structure due to the conjugated system of the aromatic rings, enhancing its stability and potential for π-π stacking interactions. It is generally soluble in organic solvents, reflecting its non-polar characteristics, while its nitrogen-containing heterocycles can participate in hydrogen bonding and coordination with metal ions. The presence of the phenyl group can influence its electronic properties, making it a candidate for various applications in medicinal chemistry, particularly in the development of pharmaceuticals. Additionally, compounds of this type may exhibit biological activities, including antimicrobial or anticancer properties, due to their ability to interact with biological targets. Overall, 2-phenyl-3H-imidazo[4,5-c]pyridine is a versatile compound with significant implications in both synthetic and medicinal chemistry.
Formula:C12H9N3
InChI:InChI=1/C12H9N3/c1-2-4-9(5-3-1)12-14-10-6-7-13-8-11(10)15-12/h1-8H,(H,14,15)
SMILES:c1ccc(cc1)c1[nH]c2ccncc2n1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
