CymitQuimica logo

CAS 7501-44-2

:

oxiran-2-ylmethyl hexadecanoate

Description:
Oxiran-2-ylmethyl hexadecanoate, also known as glycidyl hexanoate, is an organic compound characterized by its ester functional group and an epoxide ring. This compound features a hexadecanoate (palmitate) moiety, which contributes to its hydrophobic properties, making it soluble in organic solvents but less so in water. The presence of the epoxide group imparts reactivity, allowing it to participate in various chemical reactions, such as ring-opening polymerization and cross-linking, which are valuable in polymer chemistry and materials science. Oxiran-2-ylmethyl hexadecanoate is often utilized in the production of specialty chemicals, coatings, and adhesives due to its ability to enhance mechanical properties and chemical resistance. Additionally, its structure suggests potential applications in the food and cosmetic industries, where it may serve as an emulsifier or stabilizer. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose health risks upon exposure. Overall, its unique chemical structure and properties make it a versatile compound in various industrial applications.
Formula:C19H36O3
InChI:InChI=1/C19H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19(20)22-17-18-16-21-18/h18H,2-17H2,1H3
InChI key:KYVUJPJYTYQNGJ-UHFFFAOYSA-N
SMILES:CCCCCCCCCCCCCCCC(=O)OCC1CO1
Found 20 products.