CAS 75018-07-4

3-Butoxy-2-pyrazinecarbonitrile

Description:

3-Butoxy-2-pyrazinecarbonitrile is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. This compound features a butoxy group, which is an alkoxy functional group derived from butanol, contributing to its hydrophobic properties. The presence of the carbonitrile group (-C≡N) introduces a polar functional group that can participate in various chemical reactions, including nucleophilic additions and coordination with metal ions. 3-Butoxy-2-pyrazinecarbonitrile is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is often used in organic synthesis and may serve as an intermediate in the production of agrochemicals or pharmaceuticals. The compound's unique structure allows for potential applications in flavor and fragrance industries, as well as in the development of novel materials. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₁₁N₃O

InChI: InChI=1S/C9H11N3O/c1-2-3-6-13-9-8(7-10)11-4-5-12-9/h4-5H,2-3,6H2,1H3

InChI key: InChIKey=KNUUREMOVQLYSR-UHFFFAOYSA-N

SMILES: O(CCCC)C=1C(C#N)=NC=CN1

Synonyms:

• 2-Pyrazinecarbonitrile, 3-butoxy-
• 3-Butoxy-2-pyrazinecarbonitrile
• Pyrazinecarbonitrile, 3-butoxy-