CAS 75020-01-8

N-[(1E)-(2-chlorophenyl)methylidene]-4-fluoroaniline

Description:

N-[(1E)-(2-chlorophenyl)methylidene]-4-fluoroaniline, identified by its CAS number 75020-01-8, is an organic compound characterized by its unique structural features. It contains a fluoroaniline moiety, which is an aniline derivative with a fluorine substituent, and a chlorophenyl group linked through a methylene bridge. This compound exhibits properties typical of aromatic amines, including potential reactivity due to the presence of the amine functional group, which can participate in various chemical reactions such as nucleophilic substitutions. The presence of halogen atoms (chlorine and fluorine) can influence its electronic properties, making it a candidate for applications in pharmaceuticals or agrochemicals. Additionally, the compound's structural configuration suggests it may exhibit specific biological activities, although detailed studies would be necessary to elucidate its full potential. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity associated with amines and halogenated compounds.

Formula: C₁₃H₉ClFN

InChI: InChI=1/C13H9ClFN/c14-13-4-2-1-3-10(13)9-16-12-7-5-11(15)6-8-12/h1-9H/b16-9+

N-(2-Chlorobenzylidene)-4-fluoroaniline

CAS: 75020-01-8

Formula: C₁₃H₉ClFN

Purity: 95%

Color and Shape: Solid

Molecular weight: 233.6687

Ref: IN-DA003S8Z

1-(2-Chlorophenyl)-N-(4-fluorophenyl)methanimine

CAS: 75020-01-8

1-(2-Chlorophenyl)-N-(4-fluorophenyl)methanimine

Purity: 95%

Molecular weight: 233.67g/mol

Ref: 54-PC1003977