CymitQuimica logo

CAS 75024-36-1

:

methyl 2,3-dicyano-3-phenylpropanoate

Description:
Methyl 2,3-dicyano-3-phenylpropanoate, identified by its CAS number 75024-36-1, is an organic compound characterized by its ester functional group and the presence of two cyano groups attached to a propanoate backbone. This compound typically appears as a crystalline solid and is known for its relatively low solubility in water, while being more soluble in organic solvents such as ethanol and acetone. The presence of the cyano groups contributes to its reactivity, making it a useful intermediate in organic synthesis, particularly in the formation of various heterocycles and other complex molecules. Additionally, the phenyl group enhances its aromatic character, potentially influencing its electronic properties and reactivity. Methyl 2,3-dicyano-3-phenylpropanoate may exhibit biological activity, although specific applications or effects would depend on further research. As with many cyano-containing compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C12H10N2O2
InChI:InChI=1/C12H10N2O2/c1-16-12(15)11(8-14)10(7-13)9-5-3-2-4-6-9/h2-6,10-11H,1H3
SMILES:COC(=O)C(C#N)C(C#N)c1ccccc1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.