CAS 75028-28-3

2,4-Dihydro-4-(3-methoxypropyl)-3H-1,2,4-triazole-3-thione

Description:

2,4-Dihydro-4-(3-methoxypropyl)-3H-1,2,4-triazole-3-thione, with the CAS number 75028-28-3, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This substance typically exhibits properties associated with thiones, which are sulfur-containing analogs of ketones. It is often recognized for its potential applications in agriculture, particularly as a fungicide or herbicide, due to its ability to inhibit certain biological processes in target organisms. The presence of the methoxypropyl group enhances its solubility and bioavailability, making it more effective in various formulations. Additionally, compounds of this nature may exhibit moderate to high stability under standard conditions, although their reactivity can vary based on environmental factors. Safety and handling precautions are essential, as with many chemical substances, to mitigate any potential hazards associated with exposure. Overall, this compound represents a class of agrochemicals that are valuable in crop protection strategies.

Formula: C₆H₁₁N₃OS

InChI: InChI=1S/C6H11N3OS/c1-10-4-2-3-9-5-7-8-6(9)11/h5H,2-4H2,1H3,(H,8,11)

InChI key: InChIKey=ZVMQINHTYQKDLV-UHFFFAOYSA-N

SMILES: C(CCOC)N1C(=S)NN=C1

Synonyms:

• 3H-1,2,4-Triazole-3-thione, 2,4-dihydro-4-(3-methoxypropyl)-
• 2,4-Dihydro-4-(3-methoxypropyl)-3H-1,2,4-triazole-3-thione

4-(3-Methoxypropyl)-4H-1,2,4-triazole-3-thiol

CAS: 75028-28-3

4-(3-Methoxypropyl)-4H-1,2,4-triazole-3-thiol is a sulfuric acid derivative of 4H-1,2,4-triazole-3-thiol. It is an efficient and potentiodynamic polarizer that can be used to measure the concentration of copper ions in solution. This agent has been shown to have synergistic effects with copper ions and can be used as an analytical tool for cyclic voltammetry.

Formula: C₆H₁₁N₃OS

Purity: Min. 95%

Molecular weight: 173.24 g/mol

Ref: 3D-ADA02828