CAS 75028-30-7

1,2,4-Thiadiazole-3-carboxylic acid, 5-chloro-, methyl ester

Description:

1,2,4-Thiadiazole-3-carboxylic acid, 5-chloro-, methyl ester is a heterocyclic compound characterized by the presence of a thiadiazole ring, which contains both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group that is esterified with a methyl group, enhancing its solubility in organic solvents. The chlorine substituent at the 5-position of the thiadiazole ring contributes to its reactivity and potential biological activity. Typically, compounds of this nature exhibit properties such as antimicrobial, antifungal, or herbicidal activities, making them of interest in agricultural and pharmaceutical applications. The presence of the thiadiazole moiety often imparts unique electronic properties, influencing the compound's behavior in chemical reactions. Additionally, the methyl ester form can facilitate easier handling and incorporation into various chemical syntheses. Safety data should be consulted for handling and usage, as halogenated compounds can pose specific health and environmental risks. Overall, this compound represents a versatile building block in synthetic chemistry and material science.

Formula: C₄H₃ClN₂O₂S

InChI: InChI=1S/C4H3ClN2O2S/c1-9-3(8)2-6-4(5)10-7-2/h1H3

InChI key: InChIKey=QMFONQYXSHGZTA-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1N=C(Cl)SN1

Synonyms:

• Methyl 5-chloro-1,2,4-thiadiazole-3-carboxylate
• 1,2,4-Thiadiazole-3-carboxylic acid, 5-chloro-, methyl ester