
CAS 75035-33-5
:Diethylene glycol-initiated polycaprolactone
Description:
Diethylene glycol-initiated polycaprolactone (PCL) is a biodegradable polyester characterized by its flexible and elastomeric properties. It is synthesized through the ring-opening polymerization of ε-caprolactone, initiated by diethylene glycol, which serves as a low molecular weight initiator. This polymer exhibits a low glass transition temperature, making it suitable for applications requiring flexibility and elasticity. PCL is known for its biocompatibility and biodegradability, making it an attractive material for medical applications, such as drug delivery systems and tissue engineering scaffolds. Additionally, it has good mechanical properties, including tensile strength and elongation at break, which can be tailored by adjusting the molecular weight and degree of polymerization. PCL is soluble in a variety of organic solvents, enhancing its processability for various applications, including coatings and adhesives. Its degradation occurs through hydrolysis, leading to non-toxic byproducts, which further supports its use in environmentally friendly applications. Overall, diethylene glycol-initiated PCL is a versatile polymer with significant potential in both industrial and biomedical fields.
Formula:(C6H10O2)xC4H10O3
InChI:InChI=1S/C6H10O2.C4H10O3/c7-6-4-2-1-3-5-8-6;5-1-3-7-4-2-6/h1-5H2;5-6H,1-4H2
InChI key:InChIKey=QQTRSFMAONGASB-UHFFFAOYSA-N
SMILES:O(CCO)CCO.O=C1CCCCCO1
Synonyms:- 2-Oxepanone, homopolymer, ester with 2,2′-oxybis[ethanol] (2:1)
- Polycaprolactone oxydiethylene ester
- 2-Oxepanone homopolymer oxydi-2,1-ethanediyl ester
- Poly(ε-caprolactone) diester with diethylene glycol
- Caprolactone homopolymer, diester with diethylene glycol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Polycaprolactone diol - MW 525-575
CAS:<p>Biodegradable polymer</p>Formula:C4H8O3(C6H10O2)nColor and Shape:Clear Liquid
