CAS 7504-44-1
:1,3-thiazol-4-ylacetic acid
Description:
1,3-Thiazol-4-ylacetic acid is an organic compound characterized by its thiazole ring structure, which is a five-membered heterocyclic ring containing both sulfur and nitrogen atoms. This compound features a carboxylic acid functional group (-COOH) attached to the thiazole ring, specifically at the 4-position, and an acetic acid moiety at the 1-position. It is typically a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound exhibits biological activity, making it of interest in pharmaceutical research, particularly for its potential antimicrobial and anti-inflammatory properties. Its reactivity is influenced by the thiazole ring, which can participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Safety data indicates that, like many organic acids, it should be handled with care to avoid irritation to skin and eyes. Overall, 1,3-thiazol-4-ylacetic acid is a versatile compound with applications in medicinal chemistry and organic synthesis.
Formula:C5H5NO2S
InChI:InChI=1/C5H5NO2S/c7-5(8)1-4-2-9-3-6-4/h2-3H,1H2,(H,7,8)
SMILES:C(c1cscn1)C(=O)O
Synonyms:- 4-Thiazoleacetic Acid
- 7504-44-1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-(Thiazol-4-yl)acetic acid
CAS:Formula:C5H5NO2SPurity:95%Color and Shape:SolidMolecular weight:143.1637Ref: IN-DA0032UX
1g117.00€5g200.00€10g347.00€25gTo inquire100gTo inquire100mg60.00€250mg67.00€500mg92.00€(1,3-Thiazol-4-yl)acetic acid
CAS:(1,3-Thiazol-4-yl)acetic acidPurity:97%Color and Shape:SolidMolecular weight:143.16g/mol2-(Thiazol-4-yl)acetic acid
CAS:Formula:C5H5NO2SPurity:95%Color and Shape:Solid, Cream powderMolecular weight:143.161,3-Thiazol-4-ylacetic acid hydrochloride
CAS:<p>1,3-Thiazol-4-ylacetic acid hydrochloride is an antimicrobial agent that has been shown to be active against Gram-negative bacteria. It is an acidic compound that hydrolyzes in water to produce a carboxylic acid and an alcohol. 1,3-Thiazol-4-ylacetic acid hydrochloride has been used in pharmaceutical preparations as an antimicrobial and blood platelet aggregating agent. It also inhibits the coagulation of blood platelets and the aggregation of platelets. The mechanism for this may involve the interference with phospholipid biosynthesis or with the cytochrome P450 enzyme system involved in the metabolism of arachidonic acid into prostaglandins.</p>Formula:C5H5NO2SPurity:Min. 95%Molecular weight:143.16 g/mol



