CAS 75051-55-7
:1,1-Dimethylethyl N-[2-(aminooxy)ethyl]carbamate
Description:
1,1-Dimethylethyl N-[2-(aminooxy)ethyl]carbamate, with the CAS number 75051-55-7, is a chemical compound characterized by its unique structure that includes a carbamate functional group and an aminooxy moiety. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific formulation. It is soluble in polar organic solvents, which facilitates its use in various chemical reactions and applications. The presence of the aminooxy group suggests potential reactivity with carbonyl compounds, making it useful in synthetic organic chemistry, particularly in the formation of oxime derivatives. Additionally, the dimethyl group contributes to its steric hindrance, influencing its reactivity and interactions with other molecules. Safety data indicates that, like many carbamates, it should be handled with care due to potential toxicity and environmental concerns. Overall, 1,1-Dimethylethyl N-[2-(aminooxy)ethyl]carbamate is a versatile compound with applications in research and industry, particularly in the fields of medicinal chemistry and materials science.
Formula:C7H16N2O3
InChI:InChI=1S/C7H16N2O3/c1-7(2,3)12-6(10)9-4-5-11-8/h4-5,8H2,1-3H3,(H,9,10)
InChI key:InChIKey=JRLJOAREDJOYLW-UHFFFAOYSA-N
SMILES:O(C(NCCON)=O)C(C)(C)C
Synonyms:- (2-Aminooxyethyl)carbamic acid tert-butyl ester
- 1,1-Dimethylethyl N-[2-(aminooxy)ethyl]carbamate
- Carbamic acid, [2-(aminooxy)ethyl]-, 1,1-dimethylethyl ester
- Carbamicacid, [2-(aminooxy)ethyl]-, 1,1-dimethylethyl ester (9CI)
- tert-Butyl[2-(aminooxy)ethyl]carbamate
- Carbamic acid, N-[2-(aminooxy)ethyl]-, 1,1-dimethylethyl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
tert-Butyl [2-(aminooxy)ethyl]carbamate
CAS:Formula:C7H16N2O3Purity:98%Color and Shape:SolidMolecular weight:176.2135tert-Butyl N-[2-(aminooxy)ethyl]carbamate
CAS:tert-Butyl N-[2-(aminooxy)ethyl]carbamatePurity:98%Molecular weight:176.21g/moltert-Butyl N-[2-(aminooxy)ethyl]carbamate
CAS:tert-Butyl N-[2-(aminooxy)ethyl]carbamate is a fine chemical that can be used as a versatile building block in the synthesis of complex compounds. It can also be used to synthesize useful scaffolds, which are chemical substances that form the basis for the design of new drugs. This compound has CAS No. 75051-55-7 and is a useful intermediate, research chemicals, and reaction component for speciality chemicals. Tert-butyl N-[2-(aminooxy)ethyl]carbamate has been shown to have high quality and is an excellent reagent in organic synthesis.Formula:C7H16N2O3Purity:Min. 95 Area-%Color and Shape:Clear LiquidMolecular weight:176.2 g/molTERT-BUTYL 2-(AMINOOXY)ETHYLCARBAMATE
CAS:Formula:C7H16N2O3Purity:98%Color and Shape:LiquidMolecular weight:176.216



