CAS 75051-57-9
:O-[(2-Methyl-4-thiazolyl)methyl]hydroxylamine
Description:
O-[(2-Methyl-4-thiazolyl)methyl]hydroxylamine, with the CAS number 75051-57-9, is a chemical compound characterized by its hydroxylamine functional group, which is known for its reactivity, particularly in forming oximes and participating in redox reactions. The presence of the 2-methyl-4-thiazolyl moiety suggests that this compound may exhibit biological activity, potentially influencing its interaction with various biological systems. Hydroxylamines are often used in organic synthesis and can act as reducing agents. This compound may also possess specific solubility properties depending on the solvent, influenced by its polar hydroxylamine group and the thiazole ring, which can contribute to its overall hydrophobic or hydrophilic character. Additionally, the thiazole ring may impart unique electronic properties, affecting the compound's reactivity and stability. As with many chemical substances, safety data should be consulted to understand its handling, potential hazards, and environmental impact.
Formula:C5H8N2OS
InChI:InChI=1S/C5H8N2OS/c1-4-7-5(2-8-6)3-9-4/h3H,2,6H2,1H3
InChI key:InChIKey=HNXXZLPFZCYZNE-UHFFFAOYSA-N
SMILES:C(ON)C=1N=C(C)SC1
Synonyms:- O-[(2-Methyl-4-thiazolyl)methyl]hydroxylamine
- Thiazole,4-[(aminooxy)methyl]-2-methyl- (9CI)
- NSC 170939
- Thiazole, 4-[(aminooxy)methyl]-2-methyl-
- NSC 170939
- Hydroxylamine, O-[(2-methyl-4-thiazolyl)methyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.