CAS 75055-25-3

3-[(2-Chloroethyl)sulfonyl]butanoic acid

Description:

3-[(2-Chloroethyl)sulfonyl]butanoic acid is an organic compound characterized by its sulfonyl functional group and a chloroethyl substituent. It features a butanoic acid backbone, which contributes to its carboxylic acid properties, including the ability to donate protons in solution. The presence of the chloroethyl group enhances its reactivity, making it a potential electrophile in various chemical reactions. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in polar solvents due to the carboxylic acid group, while the sulfonyl and chloroethyl groups may influence its solubility and reactivity in organic solvents. The compound may exhibit biological activity, making it of interest in medicinal chemistry and agrochemical applications. Safety precautions should be taken when handling this substance, as it may pose health risks due to its reactive functional groups. Overall, 3-[(2-Chloroethyl)sulfonyl]butanoic acid is a versatile compound with potential applications in various fields of chemistry.

Formula: C₆H₁₁ClO₄S

InChI: InChI=1S/C6H11ClO4S/c1-5(4-6(8)9)12(10,11)3-2-7/h5H,2-4H2,1H3,(H,8,9)

InChI key: InChIKey=UFEOBQJIKQUZOE-UHFFFAOYSA-N

SMILES: S(C(CC(O)=O)C)(CCCl)(=O)=O

Synonyms:

• 3-[(2-Chloroethyl)sulfonyl]butanoic acid
• Butanoic acid, 3-[(2-chloroethyl)sulfonyl]-