CAS 75056-11-0
:Riddelline N-oxide
Description:
Riddelline N-oxide is a chemical compound classified as an alkaloid, specifically a derivative of the natural product riddelline. It is characterized by its unique molecular structure, which includes a nitrogen atom in an oxidized state, contributing to its reactivity and biological activity. This compound is known for its potential pharmacological properties, including cytotoxicity against certain cancer cell lines, making it of interest in medicinal chemistry and drug development. Riddelline N-oxide may exhibit various physical properties such as solubility in organic solvents and stability under specific conditions, although detailed data on its melting point, boiling point, and solubility may vary. As with many alkaloids, it is important to handle Riddelline N-oxide with care due to its potential toxicity and biological effects. Research into its mechanisms of action and therapeutic applications continues to be an area of interest within the scientific community.
Formula:C18H23NO7
InChI:InChI=1S/C18H23NO7/c1-3-12-8-11(2)18(23,10-20)17(22)25-9-13-4-6-19(24)7-5-14(15(13)19)26-16(12)21/h3-4,14-15,20,23H,2,5-10H2,1H3/b12-3-/t14-,15-,18-,19?/m1/s1
InChI key:InChIKey=NPENPMDVCQGSSO-AHPXGCJSSA-N
SMILES:O=N12[C@]3([C@@](CC1)(OC(=O)/C(=C\C)/CC(=C)[C@@](CO)(O)C(=O)OCC3=CC2)[H])[H]
Synonyms:- Riddeline N-oxide
- [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-(hydroxymethyl)-5-methylene-, 14-oxide, (3Z,6S,14aR,14bR)-
- [1,6]Dioxacyclododecino[2,3,4-gh]pyrrolizine-2,7-dione, 3-ethylidene-3,4,5,6,9,11,13,14,14a,14b-decahydro-6-hydroxy-6-(hydroxymethyl)-5-methylene-, 12-oxide, (3Z,6S,14aR,14bR)-
- Riddelline N-oxide
- Senecionan-11,16-dione, 13,19-didehydro-12,18-dihydroxy-, 4-oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Riddelliine n-oxide
CAS:Natural alkaloidFormula:C18H23NO7Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:365.38Riddelliin-N-oxid
CAS:Riddelliin-N-oxide is a pyrrolizidine alkaloid, which is a naturally occurring compound found predominantly in certain species of plants, such as those belonging to the Senecio genus. Pyrrolizidine alkaloids are primarily derived from the metabolism of plants and serve as a chemical defense against herbivory. Riddelliin-N-oxide operates through its ability to interfere with cellular activities by forming DNA adducts once metabolized into its reactive intermediates. This makes it a compound of interest in the study of genotoxicity and mutagenicity.
Formula:C18H23NO7Purity:Min. 95%Molecular weight:365.4 g/mol


