CAS 75056-97-2
:2,6-Dimethyl-4-hydroxybenzoic acid
Description:
2,6-Dimethyl-4-hydroxybenzoic acid, with the CAS number 75056-97-2, is an aromatic compound that belongs to the class of benzoic acids. It features a hydroxyl group (-OH) and two methyl groups (-CH3) attached to the benzene ring, specifically at the 2 and 6 positions relative to the carboxylic acid group (-COOH) located at the 1 position. This compound is typically a white to off-white crystalline solid, exhibiting moderate solubility in water and higher solubility in organic solvents such as ethanol and acetone. It is known for its potential applications in the synthesis of various pharmaceuticals and as an intermediate in organic synthesis. The presence of the hydroxyl group contributes to its acidity and reactivity, allowing it to participate in various chemical reactions, including esterification and acylation. Additionally, its structural characteristics may influence its biological activity, making it of interest in medicinal chemistry and materials science.
Formula:C9H10O3
InChI:InChI=1/C9H10O3/c1-5-3-7(10)4-6(2)8(5)9(11)12/h3-4,10H,1-2H3,(H,11,12)
SMILES:Cc1cc(cc(C)c1C(=O)O)O
Synonyms:- 4-Hydroxy-2,6-dimethylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
4-Hydroxy-2,6-dimethylbenzoic acid
CAS:Formula:C9H10O3Purity:95%Color and Shape:SolidMolecular weight:166.17392,6-Dimethyl-4-hydroxybenzoic acid
CAS:2,6-Dimethyl-4-hydroxybenzoic acidPurity:97%Color and Shape:PowderMolecular weight:166.17g/mol4-Hydroxy-2,6-dimethylbenzoic acid
CAS:Formula:C9H10O3Purity:95%Color and Shape:SolidMolecular weight:166.1764-Hydroxy-2,6-dimethylbenzoic acid
CAS:4-Hydroxy-2,6-dimethylbenzoicacid is a metabolite of the herbicide 2,4,5-trichlorophenoxyacetic acid and has been shown to have pharmacokinetic properties and a platelet profile similar to that of acetylsalicylic acid. The physicochemical properties of 4-hydroxy-2,6-dimethylbenzoic acid are similar to those of salicylic acid. It is conjunctival in nature and may be used for the treatment of inflammation caused by allergies or bacterial infections. This chemical also has d2 receptor binding activity which may be due to its coordination with zinc ions. Uptake mechanisms for this compound include passive diffusion and ion channel transport.
Formula:C9H10O3Purity:Min. 95%Molecular weight:166.17 g/mol



