CAS 75057-62-4

2-Amino-4,5-dibromobenzoic acid

Description:

2-Amino-4,5-dibromobenzoic acid is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with two bromine atoms and an amino group, as well as a carboxylic acid functional group. This compound typically appears as a solid at room temperature and is soluble in polar solvents due to the presence of the carboxylic acid group. The amino group can participate in hydrogen bonding, enhancing its solubility in water. The dibromination introduces significant electronegative bromine atoms, which can influence the compound's reactivity and stability, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the presence of both amino and carboxylic acid functional groups allows for potential applications in pharmaceuticals and as intermediates in organic synthesis. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₇H₅Br₂NO₂

InChI: InChI=1/C7H5Br2NO2/c8-4-1-3(7(11)12)6(10)2-5(4)9/h1-2H,10H2,(H,11,12)

SMILES: c1c(c(cc(c1Br)Br)N)C(=O)O

Synonyms:

• Benzoic Acid, 2-Amino-4,5-Dibromo-
• 2-Amino-4,5-Dibromobenzoate

2-Amino-4,5-dibromobenzoic acid

CAS: 75057-62-4

Formula: C₇H₅Br₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 294.9281

Ref: IN-DA005R0A

4,5-Dibromoanthranilic acid

CAS: 75057-62-4

4,5-Dibromoanthranilic acid

Purity: 97%

Molecular weight: 294.93g/mol

Ref: 54-OR90373

2-Amino-4,5-dibromobenzoic acid

CAS: 75057-62-4

Formula: C₇H₅Br₂NO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 294.93

Ref: 10-F092275