CAS 75057-97-5

Descarbamoylnovobiocin

Description:

Descarbamoylnovobiocin is a chemical compound that belongs to the class of antibiotics known as aminocoumarins. It is derived from novobiocin, which is produced by the bacterium *Streptomyces niveus*. This compound is characterized by its ability to inhibit bacterial DNA gyrase, an essential enzyme for DNA replication and transcription in bacteria, making it effective against a range of Gram-positive bacteria. Descarbamoylnovobiocin exhibits a relatively low toxicity profile in comparison to other antibiotics, which makes it a subject of interest in medicinal chemistry. Its structure features a coumarin core, which is modified by the removal of the carbamoyl group, leading to its unique properties. The compound is typically studied for its potential applications in treating bacterial infections and its role in understanding antibiotic resistance mechanisms. Additionally, it may have implications in research related to cancer therapy, as some studies suggest that it can affect cell proliferation. Overall, Descarbamoylnovobiocin represents a significant compound in the field of antibiotic research and development.

Formula: C₃₀H₃₅NO₁₀

InChI: InChI=1S/C30H35NO10/c1-14(2)7-8-16-13-17(9-11-19(16)32)27(36)31-21-22(33)18-10-12-20(15(3)25(18)40-28(21)37)39-29-24(35)23(34)26(38-6)30(4,5)41-29/h7,9-13,23-24,26,29,32-35H,8H2,1-6H3,(H,31,36)/t23-,24+,26+,29+/m0/s1

InChI key: InChIKey=UZHGFJZFJRMSOS-NANZAVOOSA-N

SMILES: CC1=C2C(C(O)=C(NC(=O)C3=CC(CC=C(C)C)=C(O)C=C3)C(=O)O2)=CC=C1O[C@H]4[C@H](O)[C@H](O)[C@@H](OC)C(C)(C)O4

Synonyms:

• Descarbamylnovobiocin
• Decarbamylnovobiocin
• Benzamide, N-[7-[(6-deoxy-5-C-methyl-4-O-methyl-α-L-lyxo-hexopyranosyl)oxy]-4-hydroxy-8-methyl-2-oxo-2H-1-benzopyran-3-yl]-4-hydroxy-3-(3-methyl-2-butenyl)-
• Benzamide, N-[7-[(6-deoxy-5-C-methyl-4-O-methyl-α-L-lyxo-hexopyranosyl)oxy]-4-hydroxy-8-methyl-2-oxo-2H-1-benzopyran-3-yl]-4-hydroxy-3-(3-methyl-2-buten-1-yl)-
• N-[7-[(6-Deoxy-5-C-methyl-4-O-methyl-α-L-lyxo-hexopyranosyl)oxy]-4-hydroxy-8-methyl-2-oxo-2H-1-benzopyran-3-yl]-4-hydroxy-3-(3-methyl-2-buten-1-yl)benzamide

Descarbamylnovobiocin

CAS: 75057-97-5

Descarbamylnovobiocin is a synthetic derivative of the antibiotic novobiocin, which is originally sourced from Streptomyces species. As a derivative, it modifies certain structural elements of the parent compound to potentially enhance or alter its antimicrobial properties. Its mode of action is primarily through the inhibition of bacterial DNA gyrase and topoisomerase IV, essential enzymes for DNA replication and cell division. By impeding these enzymes, descarbamylnovobiocin disrupts the supercoiling of bacterial DNA, thereby inhibiting bacterial growth and proliferation.

Formula: C₃₀H₃₅NO₁₀

Purity: Min. 95%

Molecular weight: 569.6 g/mol

Ref: 3D-ADA05797