CymitQuimica logo

CAS 750573-28-5

:

9,9′-[1,1′-Biphenyl]-3,5-diylbis[9H-carbazole]

Description:
9,9′-[1,1′-Biphenyl]-3,5-diylbis[9H-carbazole] is an organic compound characterized by its complex structure, which includes biphenyl and carbazole moieties. This substance is known for its potential applications in organic electronics, particularly in organic light-emitting diodes (OLEDs) and organic photovoltaics (OPVs), due to its excellent charge transport properties and photophysical characteristics. The presence of multiple aromatic rings contributes to its stability and ability to facilitate electron transport. Additionally, the compound exhibits strong fluorescence, making it suitable for optoelectronic applications. Its synthesis typically involves multi-step organic reactions, and it may require specific conditions to ensure high purity and yield. As with many organic compounds, handling should be done with care, considering potential toxicity and environmental impact. Overall, 9,9′-[1,1′-Biphenyl]-3,5-diylbis[9H-carbazole] represents a significant interest in materials science and organic chemistry due to its unique properties and functionalities.
Formula:C36H24N2
InChI:InChI=1S/C36H24N2/c1-2-12-25(13-3-1)26-22-27(37-33-18-8-4-14-29(33)30-15-5-9-19-34(30)37)24-28(23-26)38-35-20-10-6-16-31(35)32-17-7-11-21-36(32)38/h1-24H
InChI key:InChIKey=CVXXPNSMZIRFAA-UHFFFAOYSA-N
SMILES:N1(C=2C(C=3C1=CC=CC3)=CC=CC2)C4=CC(=CC(=C4)C5=CC=CC=C5)N6C=7C(C=8C6=CC=CC8)=CC=CC7
Synonyms:
  • 9,9′-[1,1′-Biphenyl]-3,5-diylbis[9H-carbazole]
  • 9H-Carbazole, 9,9′-[1,1′-biphenyl]-3,5-diylbis-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.