CAS 750586-00-6

2,4-Dibromo-3,5-dimethylbenzoic acid

Description:

2,4-Dibromo-3,5-dimethylbenzoic acid is an aromatic carboxylic acid characterized by the presence of two bromine atoms and two methyl groups on a benzoic acid framework. The bromine substituents are located at the 2 and 4 positions, while the methyl groups are at the 3 and 5 positions, contributing to the compound's unique chemical properties. This structure influences its reactivity, solubility, and potential applications in various fields, including pharmaceuticals and agrochemicals. The presence of the carboxylic acid functional group imparts acidic properties, allowing it to participate in acid-base reactions. Additionally, the bromine atoms can enhance the compound's reactivity in electrophilic substitution reactions. The compound is likely to exhibit moderate solubility in organic solvents and limited solubility in water due to its hydrophobic methyl groups and the bulky bromine substituents. Overall, 2,4-Dibromo-3,5-dimethylbenzoic acid is a versatile compound with potential utility in synthetic organic chemistry and material science.

Formula: C₉H₈Br₂O₂

InChI: InChI=1S/C9H8Br2O2/c1-4-3-6(9(12)13)8(11)5(2)7(4)10/h3H,1-2H3,(H,12,13)

InChI key: InChIKey=GNBXQEDTFUEXAK-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(Br)C(C)=C(Br)C(C)=C1

Synonyms:

• Benzoic acid, 2,4-dibromo-3,5-dimethyl-
• 2,4-Dibromo-3,5-dimethylbenzoic acid