CAS 75059-23-3
:Adenosine, 8-(2-propenylthio)-
Description:
Adenosine, 8-(2-propenylthio)-, also known by its CAS number 75059-23-3, is a modified nucleoside derivative of adenosine. This compound features a propenylthio group at the 8-position of the adenine moiety, which alters its biochemical properties compared to standard adenosine. The presence of the thioether group can influence its interaction with biological receptors and enzymes, potentially affecting its role in cellular signaling and metabolism. Adenosine itself is a crucial molecule in energy transfer, signaling, and regulation of various physiological processes. The modification with a propenylthio group may enhance its stability or alter its affinity for adenosine receptors, making it of interest in pharmacological research. Additionally, compounds like this can be studied for their potential therapeutic applications, including anti-inflammatory and neuroprotective effects. As with many nucleoside analogs, the specific characteristics, such as solubility, stability, and biological activity, would depend on the structural modifications introduced by the propenylthio group.
Formula:C13H17N5O4S
InChI:InChI=1/C13H17N5O4S/c1-2-3-23-13-17-7-10(14)15-5-16-11(7)18(13)12-9(21)8(20)6(4-19)22-12/h2,5-6,8-9,12,19-21H,1,3-4H2,(H2,14,15,16)
InChI key:InChIKey=ZATIFJKJPWWYAJ-WOUKDFQISA-N
SMILES:S(CC=C)C=1N(C=2C(N1)=C(N)N=CN2)[C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O
Synonyms:- Adenosine, 8-(2-propenylthio)-
- 8-Allylthioadenosine
- NSC 136563
- 8-(2-Propenylthio)adenosine
- Adenosine, 8-(2-propenylthio)- (9CI)
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
8-Allylthioadenosine
CAS:8-Allylthioadenosine is a Nucleoside Derivative - 8-Modified purine nucleoside; Thio-nucleoside.Formula:C13H17N5O4SColor and Shape:SolidMolecular weight:339.37
