CymitQuimica logo

CAS 750599-02-1

:

β-[(Aminocarbonyl)amino]-2-chlorobenzenepropanoic acid

Description:
β-[(Aminocarbonyl)amino]-2-chlorobenzenepropanoic acid, identified by its CAS number 750599-02-1, is a chemical compound characterized by its structural features that include a chlorobenzene ring and an amino acid backbone. This compound typically exhibits properties associated with both aromatic and aliphatic systems, which can influence its solubility, reactivity, and biological activity. The presence of the aminocarbonyl group suggests potential for hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Additionally, the chlorobenzene moiety may impart unique electronic properties, affecting the compound's reactivity and stability. As an amino acid derivative, it may participate in peptide synthesis or serve as a building block in drug development. The compound's specific characteristics, such as melting point, boiling point, and solubility, would depend on its molecular interactions and the environment in which it is studied. Overall, this compound represents a blend of functional groups that could be explored for various applications in pharmaceuticals and biochemistry.
Formula:C10H11ClN2O3
InChI:InChI=1S/C10H11ClN2O3/c11-7-4-2-1-3-6(7)8(5-9(14)15)13-10(12)16/h1-4,8H,5H2,(H,14,15)(H3,12,13,16)
InChI key:InChIKey=SSFXPTPGKHWHHQ-UHFFFAOYSA-N
SMILES:C(CC(O)=O)(NC(N)=O)C1=C(Cl)C=CC=C1
Synonyms:
  • β-[(Aminocarbonyl)amino]-2-chlorobenzenepropanoic acid
  • Benzenepropanoic acid, β-[(aminocarbonyl)amino]-2-chloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.