CAS 750599-07-6
:5-(5-Fluoro-2-hydroxybenzoyl)-1,2-dihydro-1-methyl-2-oxo-3-pyridinecarbonitrile
Description:
5-(5-Fluoro-2-hydroxybenzoyl)-1,2-dihydro-1-methyl-2-oxo-3-pyridinecarbonitrile is a chemical compound characterized by its complex structure, which includes a pyridine ring, a carbonitrile group, and a fluorinated aromatic moiety. The presence of a hydroxyl group and a fluorine atom on the benzoyl portion contributes to its potential biological activity and solubility properties. This compound is likely to exhibit specific interactions with biological targets due to its functional groups, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antibacterial or anticancer properties. The CAS number 750599-07-6 uniquely identifies this substance in chemical databases, facilitating research and regulatory processes. As with many organic compounds, its stability, reactivity, and solubility will depend on environmental conditions such as pH and temperature, which are critical for its practical applications in various fields.
Formula:C14H9FN2O3
InChI:InChI=1S/C14H9FN2O3/c1-17-7-9(4-8(6-16)14(17)20)13(19)11-5-10(15)2-3-12(11)18/h2-5,7,18H,1H3
InChI key:InChIKey=SGTSCHIAZHARNC-UHFFFAOYSA-N
SMILES:C(=O)(C=1C=C(C#N)C(=O)N(C)C1)C2=C(O)C=CC(F)=C2
Synonyms:- 3-Pyridinecarbonitrile, 5-(5-fluoro-2-hydroxybenzoyl)-1,2-dihydro-1-methyl-2-oxo-
- 5-(5-Fluoro-2-hydroxybenzoyl)-1,2-dihydro-1-methyl-2-oxo-3-pyridinecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.