
CAS 750599-12-3
:3-[1-(2-Furanylmethyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid
Description:
3-[1-(2-Furanylmethyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid, with the CAS number 750599-12-3, is an organic compound characterized by its unique structure that includes a furan ring and a pyrrole moiety. This compound features a propenoic acid functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the furan and pyrrole rings suggests that it may exhibit interesting biological activities, possibly including antimicrobial or anticancer properties, due to the inherent reactivity of these heterocycles. Additionally, the dimethyl substitution on the pyrrole ring may influence its electronic properties and steric hindrance, affecting its interactions with other molecules. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this substance represents a class of compounds that could be of interest in medicinal chemistry and materials science, warranting further investigation into its properties and potential applications.
Formula:C14H15NO3
InChI:InChI=1S/C14H15NO3/c1-10-8-12(5-6-14(16)17)11(2)15(10)9-13-4-3-7-18-13/h3-8H,9H2,1-2H3,(H,16,17)
InChI key:InChIKey=WXNXIYIXQNHJHO-UHFFFAOYSA-N
SMILES:C(N1C(C)=C(C=CC(O)=O)C=C1C)C2=CC=CO2
Synonyms:- 3-[1-(2-Furanylmethyl)-2,5-dimethyl-1H-pyrrol-3-yl]-2-propenoic acid
- 2-Propenoic acid, 3-[1-(2-furanylmethyl)-2,5-dimethyl-1H-pyrrol-3-yl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.