CymitQuimica logo

CAS 750624-68-1

:

2-[[5-[[(2-Chlorophenyl)amino]sulfonyl]-2-benzoxazolyl]thio]acetic acid

Description:
2-[[5-[[(2-Chlorophenyl)amino]sulfonyl]-2-benzoxazolyl]thio]acetic acid, with CAS number 750624-68-1, is a chemical compound characterized by its complex structure, which includes a benzoxazole moiety, a sulfonamide group, and a thioacetic acid functional group. This compound typically exhibits properties associated with both acidic and aromatic functionalities, making it potentially useful in various chemical applications, including medicinal chemistry. The presence of the chlorophenyl group suggests that it may have specific biological activities, possibly influencing its interaction with biological targets. Additionally, the sulfonyl group can enhance solubility and stability in biological systems. The compound's molecular structure may contribute to its potential as a pharmacological agent, although specific biological activities would need to be evaluated through empirical studies. Overall, this compound represents a class of sulfonamide derivatives that may have significant implications in drug development and therapeutic applications.
Formula:C15H11ClN2O5S2
InChI:InChI=1S/C15H11ClN2O5S2/c16-10-3-1-2-4-11(10)18-25(21,22)9-5-6-13-12(7-9)17-15(23-13)24-8-14(19)20/h1-7,18H,8H2,(H,19,20)
InChI key:InChIKey=FSOHVUYTPPUSFM-UHFFFAOYSA-N
SMILES:S(NC1=C(Cl)C=CC=C1)(=O)(=O)C=2C=C3C(OC(SCC(O)=O)=N3)=CC2
Synonyms:
  • Acetic acid, 2-[[5-[[(2-chlorophenyl)amino]sulfonyl]-2-benzoxazolyl]thio]-
  • 2-[[5-[[(2-Chlorophenyl)amino]sulfonyl]-2-benzoxazolyl]thio]acetic acid
  • Acetic acid, [[5-[[(2-chlorophenyl)amino]sulfonyl]-2-benzoxazolyl]thio]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.