CAS 750633-46-6

(4-fluorophenyl)(2-methoxyphenyl)methanone

Description:

(4-fluorophenyl)(2-methoxyphenyl)methanone, also known by its CAS number 750633-46-6, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a methanone moiety bonded to two distinct aromatic rings: one containing a fluorine substituent at the para position and the other containing a methoxy group at the ortho position. The presence of the fluorine atom can influence the compound's electronic properties, potentially enhancing its reactivity and solubility in various solvents. The methoxy group, being an electron-donating substituent, can also affect the compound's overall stability and reactivity. This compound may exhibit interesting biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in organic synthesis and medicinal chemistry, where modifications to the aromatic rings could lead to derivatives with varied properties. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₄H₁₁FO₂

InChI: InChI=1/C14H11FO2/c1-17-13-5-3-2-4-12(13)14(16)10-6-8-11(15)9-7-10/h2-9H,1H3

SMILES: COc1ccccc1C(=O)c1ccc(cc1)F