CAS 750633-48-8
:(2-Methoxyphenyl)(4-pentylphenyl)methanone
Description:
(2-Methoxyphenyl)(4-pentylphenyl)methanone, with the CAS number 750633-48-8, is an organic compound characterized by its ketone functional group and the presence of two distinct aromatic rings. The structure features a methoxy group (-OCH3) attached to a phenyl ring, which contributes to its electron-donating properties, enhancing the compound's reactivity. The second aromatic ring is substituted with a pentyl group, which adds hydrophobic characteristics and influences the compound's solubility in organic solvents. This compound may exhibit interesting photophysical properties, making it potentially useful in applications such as organic light-emitting diodes (OLEDs) or as a dye in various chemical processes. Its molecular structure suggests that it could participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic addition, depending on the reaction conditions. Additionally, the presence of both methoxy and pentyl substituents can affect the compound's stability, boiling point, and melting point, which are important for its practical applications in chemical synthesis and materials science.
Formula:C19H22O2
InChI:InChI=1S/C19H22O2/c1-3-4-5-8-15-11-13-16(14-12-15)19(20)17-9-6-7-10-18(17)21-2/h6-7,9-14H,3-5,8H2,1-2H3
InChI key:InChIKey=LMMHHEITNNBFCZ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=CC=C1)C2=CC=C(CCCCC)C=C2
Synonyms:- Methanone, (2-methoxyphenyl)(4-pentylphenyl)-
- (2-Methoxyphenyl)(4-pentylphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.