CAS 750633-53-5
:(3,4-dimethylphenyl)-(2-methoxyphenyl)methanone
Description:
(3,4-Dimethylphenyl)-(2-methoxyphenyl)methanone, identified by its CAS number 750633-53-5, is an organic compound characterized by its ketone functional group. This substance features a central carbon atom bonded to two aromatic rings: one containing two methyl groups at the 3 and 4 positions, and the other containing a methoxy group at the 2 position. The presence of these substituents influences its physical and chemical properties, such as solubility, boiling point, and reactivity. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic structures, which can affect their behavior in biological systems and their potential applications in pharmaceuticals or materials science. The methoxy group can also enhance the compound's electron-donating properties, potentially influencing its reactivity in various chemical reactions. Overall, the unique arrangement of substituents in (3,4-dimethylphenyl)-(2-methoxyphenyl)methanone contributes to its distinct characteristics and potential utility in various chemical applications.
Formula:C16H16O2
InChI:InChI=1/C16H16O2/c1-11-8-9-13(10-12(11)2)16(17)14-6-4-5-7-15(14)18-3/h4-10H,1-3H3
SMILES:Cc1ccc(cc1C)C(=O)c1ccccc1OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.