CAS 750633-55-7
:(4-Bromo-3-fluorophenyl)(2-methoxyphenyl)methanone
Description:
(4-Bromo-3-fluorophenyl)(2-methoxyphenyl)methanone, with the CAS number 750633-55-7, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, indicated by the presence of the methanone moiety, which is attached to two distinct phenyl groups. One of these groups contains both a bromine and a fluorine substituent, contributing to its unique electronic properties and potential reactivity. The presence of the methoxy group on the second phenyl ring enhances its solubility in organic solvents and may influence its biological activity. This compound is likely to exhibit interesting chemical behavior due to the electron-withdrawing effects of the halogen substituents, which can affect its reactivity in electrophilic aromatic substitution reactions. Additionally, the structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where such modifications can enhance biological activity or selectivity. Overall, this compound exemplifies the intricate interplay of functional groups in organic chemistry, leading to diverse chemical properties and potential applications.
Formula:C14H10BrFO2
InChI:InChI=1S/C14H10BrFO2/c1-18-13-5-3-2-4-10(13)14(17)9-6-7-11(15)12(16)8-9/h2-8H,1H3
InChI key:InChIKey=RLNRQSBJFROXIJ-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(OC)C=CC=C1)C2=CC(F)=C(Br)C=C2
Synonyms:- (4-Bromo-3-fluorophenyl)(2-methoxyphenyl)methanone
- Methanone, (4-bromo-3-fluorophenyl)(2-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.