CAS 750633-59-1

3-(3-Methoxybenzoyl)benzonitrile

Description:

3-(3-Methoxybenzoyl)benzonitrile, identified by its CAS number 750633-59-1, is an organic compound characterized by its structure, which includes a benzene ring substituted with both a methoxy group and a benzonitrile moiety. This compound typically exhibits properties associated with aromatic compounds, such as stability and relatively high melting and boiling points compared to aliphatic compounds. The presence of the methoxy group can influence its solubility in organic solvents and may enhance its reactivity in certain chemical reactions, such as electrophilic aromatic substitution. Additionally, the benzonitrile group contributes to the compound's potential applications in organic synthesis and materials science, particularly in the development of pharmaceuticals and agrochemicals. The compound may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, 3-(3-Methoxybenzoyl)benzonitrile is a notable compound in the realm of organic chemistry, with potential utility in various chemical applications.

Formula: C₁₅H₁₁NO₂

InChI: InChI=1S/C15H11NO2/c1-18-14-7-3-6-13(9-14)15(17)12-5-2-4-11(8-12)10-16/h2-9H,1H3

InChI key: InChIKey=JANXXVJXZIIACM-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(C#N)=CC=C1)C2=CC(OC)=CC=C2

Synonyms:

• 3-Cyano-3′-methoxybenzophenone
• Benzonitrile, 3-(3-methoxybenzoyl)-
• 3-(3-Methoxybenzoyl)benzonitrile