CAS 750633-60-4
:4-(3-Methoxybenzoyl)benzonitrile
Description:
4-(3-Methoxybenzoyl)benzonitrile, with the CAS number 750633-60-4, is an organic compound characterized by its aromatic structure, which includes a benzoyl group and a cyano group. This compound features a methoxy substituent on the aromatic ring, contributing to its chemical properties and reactivity. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents due to its non-polar characteristics. The presence of the cyano group (-C≡N) suggests potential applications in organic synthesis and materials science, as it can participate in various chemical reactions, including nucleophilic additions and cycloadditions. Additionally, the methoxy group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with other molecules. Overall, 4-(3-Methoxybenzoyl)benzonitrile is of interest in fields such as pharmaceuticals, agrochemicals, and organic materials, where its unique structural features can be leveraged for specific applications.
Formula:C15H11NO2
InChI:InChI=1S/C15H11NO2/c1-18-14-4-2-3-13(9-14)15(17)12-7-5-11(10-16)6-8-12/h2-9H,1H3
InChI key:InChIKey=TZKPZLKZSQMCJL-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(OC)=CC=C1)C2=CC=C(C#N)C=C2
Synonyms:- 4-Cyano-3′-methoxybenzophenone
- Benzonitrile, 4-(3-methoxybenzoyl)-
- 4-(3-Methoxybenzoyl)benzonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.