CAS 750633-63-7
:(3-methoxyphenyl)-(2-methylsulfanylphenyl)methanone
Description:
(3-Methoxyphenyl)-(2-methylsulfanylphenyl)methanone, identified by its CAS number 750633-63-7, is an organic compound characterized by its unique structure, which includes a methoxy group and a methylthio group attached to phenyl rings. This compound typically exhibits properties associated with aromatic ketones, such as stability and moderate reactivity due to the presence of the carbonyl group. The methoxy group can enhance the compound's solubility in organic solvents and may influence its electronic properties, potentially making it a candidate for various chemical reactions or applications in organic synthesis. The methylthio group can also impart specific reactivity patterns, particularly in nucleophilic substitution reactions. Additionally, the compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where modifications of aromatic systems are common. Overall, the characteristics of this compound, including its solubility, reactivity, and potential applications, make it of interest in both academic and industrial chemistry contexts.
Formula:C15H14O2S
InChI:InChI=1/C15H14O2S/c1-17-12-7-5-6-11(10-12)15(16)13-8-3-4-9-14(13)18-2/h3-10H,1-2H3
SMILES:COc1cccc(c1)C(=O)c1ccccc1SC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.