CymitQuimica logo

CAS 750633-64-8

:

(3-methoxyphenyl)-(4-methylsulfanylphenyl)methanone

Description:
(3-Methoxyphenyl)-(4-methylsulfanylphenyl)methanone, identified by its CAS number 750633-64-8, is an organic compound characterized by its structure, which includes a methoxy group and a methylsulfanyl group attached to phenyl rings. This compound typically exhibits properties common to aromatic ketones, such as a relatively high melting point and stability under standard conditions. The presence of the methoxy group can influence its solubility in polar solvents, while the methylsulfanyl group may impart unique reactivity and interaction with biological systems. The compound is likely to be a solid at room temperature and may have applications in organic synthesis or as an intermediate in the production of more complex molecules. Its specific reactivity and potential applications would depend on the functional groups present and their electronic effects. As with many organic compounds, safety precautions should be taken when handling it, including the use of appropriate personal protective equipment and adherence to safety data sheet guidelines.
Formula:C15H14O2S
InChI:InChI=1/C15H14O2S/c1-17-13-5-3-4-12(10-13)15(16)11-6-8-14(18-2)9-7-11/h3-10H,1-2H3
SMILES:COc1cccc(c1)C(=O)c1ccc(cc1)SC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.