CAS 750633-66-0
:(3-bromophenyl)(3-methoxyphenyl)methanone
Description:
(3-bromophenyl)(3-methoxyphenyl)methanone, with the CAS number 750633-66-0, is an organic compound characterized by its ketone functional group and the presence of two aromatic rings. The structure features a bromine atom substituted on one phenyl ring and a methoxy group (-OCH3) on the other, which can influence its reactivity and solubility. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic systems, making it soluble in organic solvents but less so in water. The bromine substituent can enhance the compound's electrophilicity, while the methoxy group may provide electron-donating effects, potentially influencing its chemical behavior in reactions such as electrophilic aromatic substitution. Additionally, the presence of these substituents can affect the compound's biological activity, making it of interest in medicinal chemistry and material science. Overall, (3-bromophenyl)(3-methoxyphenyl)methanone is a versatile compound with potential applications in various chemical and pharmaceutical fields.
Formula:C14H11BrO2
InChI:InChI=1/C14H11BrO2/c1-17-13-7-3-5-11(9-13)14(16)10-4-2-6-12(15)8-10/h2-9H,1H3
SMILES:COc1cccc(c1)C(=O)c1cccc(c1)Br
Synonyms:- Methanone, (3-bromophenyl)(3-methoxyphenyl)-
- (3-Bromophenyl)(3-methoxyphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.