CAS 750633-68-2
:(3-methoxyphenyl)-(4-pentylphenyl)methanone
Description:
(3-Methoxyphenyl)-(4-pentylphenyl)methanone, identified by its CAS number 750633-68-2, is an organic compound characterized by its ketone functional group and the presence of two distinct aromatic rings. The structure features a methoxy group (-OCH3) attached to one of the phenyl rings, which can influence its reactivity and solubility. The presence of a pentyl group (-C5H11) on the other phenyl ring contributes to its hydrophobic characteristics, potentially affecting its physical properties such as melting point and boiling point. This compound may exhibit interesting optical and electronic properties due to its conjugated system, making it of interest in materials science and organic electronics. Additionally, the methoxy and pentyl substituents can impact its interactions in biological systems, suggesting potential applications in pharmaceuticals or as a chemical intermediate. Overall, the unique combination of functional groups and structural features makes (3-methoxyphenyl)-(4-pentylphenyl)methanone a compound of interest in various fields of chemistry.
Formula:C19H22O2
InChI:InChI=1/C19H22O2/c1-3-4-5-7-15-10-12-16(13-11-15)19(20)17-8-6-9-18(14-17)21-2/h6,8-14H,3-5,7H2,1-2H3
SMILES:CCCCCc1ccc(cc1)C(=O)c1cccc(c1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.