CymitQuimica logo

CAS 750633-70-6

:

(2,4-dimethylphenyl)-(3-methoxyphenyl)methanone

Description:
(2,4-Dimethylphenyl)-(3-methoxyphenyl)methanone, with the CAS number 750633-70-6, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a methanone moiety bonded to two aromatic rings: one substituted with two methyl groups at the 2 and 4 positions and the other with a methoxy group at the 3 position. The presence of these substituents influences its physical and chemical properties, such as solubility, boiling point, and reactivity. Generally, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic character, which can affect their biological activity and interaction with other molecules. Additionally, the methoxy group can enhance the electron-donating ability of the aromatic ring, potentially influencing the compound's reactivity in electrophilic aromatic substitution reactions. Overall, this compound may be of interest in various fields, including organic synthesis and medicinal chemistry, due to its unique structural features and potential applications.
Formula:C16H16O2
InChI:InChI=1/C16H16O2/c1-11-7-8-15(12(2)9-11)16(17)13-5-4-6-14(10-13)18-3/h4-10H,1-3H3
SMILES:Cc1ccc(c(C)c1)C(=O)c1cccc(c1)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.