CymitQuimica logo

CAS 750633-72-8

:

(2,6-dimethylphenyl)-(3-methoxyphenyl)methanone

Description:
(2,6-Dimethylphenyl)-(3-methoxyphenyl)methanone, identified by its CAS number 750633-72-8, is an organic compound characterized by its ketone functional group, specifically a methanone structure. This compound features a central carbonyl group (C=O) bonded to two distinct aromatic rings: one bearing two methyl groups at the 2 and 6 positions and the other containing a methoxy group at the 3 position. The presence of these substituents influences its physical and chemical properties, such as solubility, boiling point, and reactivity. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic character, which can affect their biological activity and interactions in various chemical environments. Additionally, the methoxy group can enhance electron donation, potentially influencing the compound's reactivity in electrophilic aromatic substitution reactions. Overall, this compound may be of interest in fields such as medicinal chemistry, materials science, or organic synthesis, depending on its specific applications and properties.
Formula:C16H16O2
InChI:InChI=1/C16H16O2/c1-11-6-4-7-12(2)15(11)16(17)13-8-5-9-14(10-13)18-3/h4-10H,1-3H3
SMILES:Cc1cccc(C)c1C(=O)c1cccc(c1)OC
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.