CAS 750633-73-9
:(3,4-dimethylphenyl)-(3-methoxyphenyl)methanone
Description:
(3,4-Dimethylphenyl)-(3-methoxyphenyl)methanone, identified by its CAS number 750633-73-9, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features two aromatic rings: one with two methyl substituents at the 3 and 4 positions, and the other with a methoxy group at the 3 position. The presence of these substituents influences its physical and chemical properties, such as solubility, melting point, and reactivity. Typically, compounds of this nature exhibit moderate to high lipophilicity due to their aromatic character, which can affect their behavior in biological systems. Additionally, the methoxy group can enhance the electron-donating ability of the aromatic ring, potentially impacting the compound's reactivity in electrophilic aromatic substitution reactions. Overall, (3,4-dimethylphenyl)-(3-methoxyphenyl)methanone is of interest in various fields, including organic synthesis and medicinal chemistry, due to its structural features that may contribute to biological activity or serve as intermediates in the synthesis of more complex molecules.
Formula:C16H16O2
InChI:InChI=1/C16H16O2/c1-11-7-8-14(9-12(11)2)16(17)13-5-4-6-15(10-13)18-3/h4-10H,1-3H3
SMILES:Cc1ccc(cc1C)C(=O)c1cccc(c1)OC
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.