CAS 750633-75-1
:(4-Bromo-3-fluorophenyl)(3-methoxyphenyl)methanone
Description:
(4-Bromo-3-fluorophenyl)(3-methoxyphenyl)methanone, with the CAS number 750633-75-1, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, indicated by the "methanone" part of its name, which is attached to two distinct phenyl groups. One of these groups contains a bromine and a fluorine substituent, contributing to its unique reactivity and potential applications in medicinal chemistry. The presence of the methoxy group on the second phenyl ring enhances its electron-donating properties, which can influence the compound's overall electronic characteristics and solubility. This compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in drug development or as a chemical intermediate. Its synthesis and reactivity can be influenced by the substituents on the aromatic rings, which can affect its stability and interactions with other chemical species. Overall, this compound represents a valuable structure in the field of organic chemistry and pharmaceuticals.
Formula:C14H10BrFO2
InChI:InChI=1S/C14H10BrFO2/c1-18-11-4-2-3-9(7-11)14(17)10-5-6-12(15)13(16)8-10/h2-8H,1H3
InChI key:InChIKey=DJHOQJWPFZDYMU-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(Br)C=C1)C2=CC(OC)=CC=C2
Synonyms:- Methanone, (4-bromo-3-fluorophenyl)(3-methoxyphenyl)-
- (4-Bromo-3-fluorophenyl)(3-methoxyphenyl)methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.