CAS 750633-76-2
:(4-Chloro-3-fluorophenyl)(3-methoxyphenyl)methanone
Description:
(4-Chloro-3-fluorophenyl)(3-methoxyphenyl)methanone, with the CAS number 750633-76-2, is an organic compound characterized by its complex aromatic structure. It features a ketone functional group, indicated by the "methanone" part of its name, which is attached to two distinct phenyl groups. One of these groups contains a chlorine and a fluorine substituent, while the other has a methoxy group, contributing to its overall reactivity and potential biological activity. The presence of halogens (chlorine and fluorine) often enhances lipophilicity and can influence the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially modulating its pharmacological effects. This compound may be explored for various applications, including in the development of pharmaceuticals or agrochemicals, due to its unique structural features that can influence its chemical behavior and biological activity.
Formula:C14H10ClFO2
InChI:InChI=1S/C14H10ClFO2/c1-18-11-4-2-3-9(7-11)14(17)10-5-6-12(15)13(16)8-10/h2-8H,1H3
InChI key:InChIKey=RTXFJYBXIYUSGO-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC(F)=C(Cl)C=C1)C2=CC(OC)=CC=C2
Synonyms:- (4-Chloro-3-fluorophenyl)(3-methoxyphenyl)methanone
- Methanone, (4-chloro-3-fluorophenyl)(3-methoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.