CAS 750633-77-3

(3-chloro-4-fluoro-phenyl)-(3-methoxyphenyl)methanone

Description:

(3-chloro-4-fluoro-phenyl)-(3-methoxyphenyl)methanone, identified by its CAS number 750633-77-3, is an organic compound characterized by its complex aromatic structure. This molecule features a ketone functional group, indicated by the methanone moiety, which is attached to two distinct aromatic rings. One ring contains both a chlorine and a fluorine substituent, contributing to its electronic properties and potential reactivity. The presence of the methoxy group on the second aromatic ring enhances its solubility and may influence its biological activity. The compound's molecular structure suggests potential applications in pharmaceuticals or agrochemicals, as halogenated aromatic compounds often exhibit significant biological activity. Additionally, the specific arrangement of substituents can affect the compound's physical properties, such as melting point, boiling point, and solubility in various solvents. Overall, this compound exemplifies the intricate interplay of functional groups and substituents in determining the chemical behavior and potential applications of organic molecules.

Formula: C₁₄H₁₀ClFO₂

InChI: InChI=1/C14H10ClFO2/c1-18-11-4-2-3-9(7-11)14(17)10-5-6-13(16)12(15)8-10/h2-8H,1H3

SMILES: COc1cccc(c1)C(=O)c1ccc(c(c1)Cl)F