CymitQuimica logo

CAS 750635-90-6

:

Mpeg butyrald

Description:
MPEG butyrald, identified by its CAS number 750635-90-6, is a chemical compound that belongs to the class of polyether compounds. It is characterized by the presence of a methoxy poly(ethylene glycol) (MPEG) structure, which contributes to its solubility in water and various organic solvents. The butyraldehyde moiety in its structure imparts specific reactivity, making it useful in various chemical applications, including as a building block in polymer synthesis and as a potential intermediate in organic reactions. MPEG butyrald is typically a colorless to pale yellow liquid with a low viscosity, and it exhibits low volatility. Its properties make it suitable for use in formulations such as coatings, adhesives, and surfactants. Additionally, the compound's compatibility with other materials and its ability to modify surface properties enhance its utility in industrial applications. Safety data should be consulted to understand its handling and potential hazards, as with any chemical substance.
Formula:(C2H4O)nC14H27NO7
Synonyms:
  • Mpeg butyrald
  • Poly(oxy-1,2-ethanediyl), α-(1,18-dioxo-5,8,11,14-tetraoxa-2-azaoctadec-1-yl)-ω-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.