CAS 7507-32-6

(4-propylphenoxy)acetic acid

Description:

(4-Propylphenoxy)acetic acid, with the CAS number 7507-32-6, is an organic compound characterized by its phenoxyacetic acid structure, where a propyl group is attached to the para position of the phenyl ring. This compound typically appears as a white to off-white solid or crystalline substance. It is known for its role as a herbicide, particularly in agricultural applications, where it functions by mimicking plant hormones, disrupting normal growth processes in target weeds. The compound is moderately soluble in water and exhibits varying solubility in organic solvents, which can influence its bioavailability and efficacy in different environments. Its chemical properties include a carboxylic acid functional group, which contributes to its acidity and potential reactivity. Safety data indicates that, like many chemical substances, it should be handled with care, as it may pose environmental risks if not managed properly. Overall, (4-propylphenoxy)acetic acid is significant in both chemical research and practical applications in agriculture.

Formula: C₁₁H₁₄O₃

InChI: InChI=1/C11H14O3/c1-2-3-9-4-6-10(7-5-9)14-8-11(12)13/h4-7H,2-3,8H2,1H3,(H,12,13)

SMILES: CCCc1ccc(cc1)OCC(=O)O

Synonyms:

• Acetic Acid, 2-(4-Propylphenoxy)-
• (4-Propylphenoxy)acetic acid

2-(4-Propylphenoxy)acetic acid

CAS: 7507-32-6

Versatile small molecule scaffold

Formula: C₁₁H₁₄O₃

Purity: Min. 95%

Molecular weight: 194.23 g/mol

Ref: 3D-HAA50732