CAS 7507-34-8

3-(3,5-dimethylphenoxy)propanoic acid

Description:

3-(3,5-Dimethylphenoxy)propanoic acid, with the CAS number 7507-34-8, is an organic compound characterized by its structure, which includes a propanoic acid moiety linked to a 3,5-dimethylphenoxy group. This compound typically exhibits properties associated with both aromatic and carboxylic acid functionalities. It is likely to be a white to off-white solid at room temperature, with moderate solubility in organic solvents and limited solubility in water due to its hydrophobic aromatic component. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical and agrochemical research. Its molecular structure suggests potential applications in the development of herbicides or other agrochemicals, as well as in the synthesis of more complex organic molecules. Safety data should be consulted for handling and usage, as with any chemical substance.

Formula: C₁₁H₁₄O₃

InChI: InChI=1/C11H14O3/c1-8-5-9(2)7-10(6-8)14-4-3-11(12)13/h5-7H,3-4H2,1-2H3,(H,12,13)

SMILES: Cc1cc(C)cc(c1)OCCC(=O)O

3-(3,5-Dimethylphenoxy)propanoic acid

CAS: 7507-34-8

Versatile small molecule scaffold

Formula: C₁₁H₁₄O₃

Purity: Min. 95%

Molecular weight: 194.23 g/mol

Ref: 3D-HAA50734