CAS 7507-40-6
:9H-fluorene-2-carboxylic acid
Description:
9H-Fluorene-2-carboxylic acid is an organic compound characterized by its structure, which consists of a fluorene backbone with a carboxylic acid functional group at the 2-position. This compound typically appears as a white to off-white solid and is known for its aromatic properties due to the presence of the fluorene moiety. It is soluble in organic solvents such as ethanol and acetone but has limited solubility in water. The carboxylic acid group imparts acidic characteristics, allowing it to participate in various chemical reactions, including esterification and amidation. 9H-Fluorene-2-carboxylic acid is often utilized in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals, due to its ability to serve as a building block for more complex molecules. Additionally, it may exhibit interesting photophysical properties, making it a subject of study in materials science and organic electronics. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C14H10O2
InChI:InChI=1/C14H10O2/c15-14(16)10-5-6-13-11(8-10)7-9-3-1-2-4-12(9)13/h1-6,8H,7H2,(H,15,16)
SMILES:c1ccc2c(c1)Cc1cc(ccc21)C(=O)O
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
9H-Fluorene-2-Carboxylic Acid
CAS:9H-Fluorene-2-Carboxylic AcidFormula:C14H10O2Purity:99%Molecular weight:210.239H-Fluorene-2-carboxylic acid
CAS:9H-Fluorene-2-carboxylic acid is a fluorescent chemical that has been modified to include fluorine atoms. Fluorescence is a property of 9H-fluorene-2-carboxylic acid that can be used to track its distribution in the body. This modification also reduces the affinity for the D4 receptor, which may lead to side effects such as mitogenesis, and it does not have any effect on dopamine D3 receptors. The synthesis of this compound is possible through a reaction with an olefinic compound in nonpolar solvents or solvents. The linker between the fluorene moiety and the carboxylic acid group may be important for determining its biological activity.Formula:C14H10O2Purity:Min. 95%Molecular weight:210.23 g/mol

