CAS 7508-02-3

1,1'-(3,5-dimethoxybenzene-1,2-diyl)diethanone

Description:

1,1'-(3,5-Dimethoxybenzene-1,2-diyl)diethanone, with the CAS number 7508-02-3, is an organic compound characterized by its structure, which features a central benzene ring substituted with two methoxy groups and two ethyl ketone functionalities. This compound is typically a solid at room temperature and exhibits a relatively high melting point due to its molecular structure. The presence of methoxy groups enhances its solubility in organic solvents and may influence its reactivity, making it a potential candidate for various chemical reactions, including those in synthetic organic chemistry. Its functional groups suggest that it may participate in electrophilic aromatic substitution reactions and could serve as a precursor for more complex molecules. Additionally, the compound may exhibit interesting optical properties due to its conjugated system, which can be explored in applications such as dyes or pharmaceuticals. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₁₂H₁₄O₄

InChI: InChI=1/C12H14O4/c1-7(13)10-5-9(15-3)6-11(16-4)12(10)8(2)14/h5-6H,1-4H3

Synonyms:

• ethanone, 1,1'-(3,5-dimethoxy-1,2-phenylene)bis-

1,1'-(3,5-Dimethoxy-1,2-phenylene)di(ethan-1-one)

CAS: 7508-02-3

1,1'-(3,5-Dimethoxy-1,2-phenylene)di(ethan-1-one)

Purity: ≥95%

Molecular weight: 222.241g/mol

Ref: 54-OR1002603