CAS 7508-05-6

1-(2,3,4,6-tetramethoxyphenyl)ethanone

Description:

1-(2,3,4,6-tetramethoxyphenyl)ethanone, with the CAS number 7508-05-6, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a phenyl ring that is heavily substituted with four methoxy groups (-OCH3) at the 2, 3, 4, and 6 positions, which significantly influences its chemical properties and reactivity. The presence of these methoxy groups enhances the compound's solubility in organic solvents and can affect its electronic properties, making it a potential candidate for various applications in organic synthesis and materials science. The ethanone moiety contributes to its reactivity, allowing for potential transformations in synthetic pathways. Additionally, the compound may exhibit interesting biological activities due to its structural features, making it a subject of interest in medicinal chemistry. Overall, 1-(2,3,4,6-tetramethoxyphenyl)ethanone is a versatile compound with unique characteristics stemming from its functional groups and aromatic system.

Formula: C₁₂H₁₆O₅

InChI: InChI=1/C12H16O5/c1-7(13)10-8(14-2)6-9(15-3)11(16-4)12(10)17-5/h6H,1-5H3

SMILES: CC(=O)c1c(cc(c(c1OC)OC)OC)OC

Synonyms:

• 2,3,4,6-Tetramethoxy-Acetophenone
• Ethanone, 1-(2,3,4,6-Tetramethoxyphenyl)-
• 1-(2,3,4,6-Tetramethoxyphenyl)ethanone

2,4,5,6-Tetramethoxyacetophenone

CAS: 7508-05-6

2,4,5,6-Tetramethoxyacetophenone is a versatile building block that can be used as an intermediate in the production of complex compounds and speciality chemicals. This compound is a useful scaffold for research chemicals and reaction components. It has CAS No. 7508-05-6 and a high quality.

Formula: C₁₂H₁₆O₅

Purity: Min. 95%

Molecular weight: 240.25 g/mol

Ref: 3D-FT70304